C22H24O — CID 54267141
[7-(5-phenylpentyl)naphthalen-1-yl]methanol (PubChem CID 54267141) has the molecular formula C22H24O and a molecular weight of 304.43 g/mol. Its IUPAC name is [7-(5-phenylpentyl)naphthalen-1-yl]methanol.
| Compound Name | [7-(5-phenylpentyl)naphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 54267141 |
| Molecular Formula | C22H24O |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | [7-(5-phenylpentyl)naphthalen-1-yl]methanol |
| SMILES | OCc1cccc2ccc(CCCCCc3ccccc3)cc12 |
| InChI | InChI=1S/C22H24O/c23-17-21-13-7-12-20-15-14-19(16-22(20)21)11-6-2-5-10-18-8-3-1-4-9-18/h1,3-4,7-9,12-16,23H,2,5-6,10-11,17H2 |
| InChIKey | RHOCWZFMEJVVMR-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|