C19H24O — CID 139920561
[3-(6-phenylhexyl)phenyl]methanol (PubChem CID 139920561) has the molecular formula C19H24O and a molecular weight of 268.40 g/mol. Its IUPAC name is [3-(6-phenylhexyl)phenyl]methanol.
| Compound Name | [3-(6-phenylhexyl)phenyl]methanol |
|---|---|
| PubChem CID | 139920561 |
| Molecular Formula | C19H24O |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | [3-(6-phenylhexyl)phenyl]methanol |
| SMILES | OCc1cccc(CCCCCCc2ccccc2)c1 |
| InChI | InChI=1S/C19H24O/c20-16-19-14-8-13-18(15-19)12-5-2-1-4-9-17-10-6-3-7-11-17/h3,6-8,10-11,13-15,20H,1-2,4-5,9,12,16H2 |
| InChIKey | HUMJCPFYJPHRCC-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|