C29H31BrO2 — CID 54401761
(4-bromophenyl)-[(2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxiran-2-yl]methanone (PubChem CID 54401761) has the molecular formula C29H31BrO2 and a molecular weight of 491.47 g/mol. Its IUPAC name is (4-bromophenyl)-[(2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxiran-2-yl]methanone.
| Compound Name | (4-bromophenyl)-[(2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxiran-2-yl]methanone |
|---|---|
| PubChem CID | 54401761 |
| Molecular Formula | C29H31BrO2 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | (4-bromophenyl)-[(2S,3R)-3-[2-(8-phenyloctyl)phenyl]oxiran-2-yl]methanone |
| SMILES | O=C(c1ccc(Br)cc1)[C@H]1O[C@@H]1c1ccccc1CCCCCCCCc1ccccc1 |
| InChI | InChI=1S/C29H31BrO2/c30-25-20-18-24(19-21-25)27(31)29-28(32-29)26-17-11-10-16-23(26)15-9-4-2-1-3-6-12-22-13-7-5-8-14-22/h5,7-8,10-11,13-14,16-21,28-29H,1-4,6,9,12,15H2/t28-,29-/m1/s1 |
| InChIKey | VNXHHISFJRFALG-FQLXRVMXSA-N |
| XLogP | 7.90 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|