C21H18O4 — CID 130428367
(1R,2S,3R,4S)-3-(4-ethynylphenoxy)carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid (PubChem CID 130428367) has the molecular formula C21H18O4 and a molecular weight of 334.37 g/mol. Its IUPAC name is (1R,2S,3R,4S)-3-(4-ethynylphenoxy)carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid.
| Compound Name | (1R,2S,3R,4S)-3-(4-ethynylphenoxy)carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 130428367 |
| Molecular Formula | C21H18O4 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | (1R,2S,3R,4S)-3-(4-ethynylphenoxy)carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid |
| SMILES | C#Cc1ccc(OC(=O)[C@@H]2[C@@H](C)[C@@H](C(=O)O)[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H18O4/c1-3-14-9-11-16(12-10-14)25-21(24)18-13(2)17(20(22)23)19(18)15-7-5-4-6-8-15/h1,4-13,17-19H,2H3,(H,22,23)/t13-,17+,18+,19-/m0/s1 |
| InChIKey | JQMKXXJFSJALLK-CJODITQLSA-N |
| XLogP | 3.32 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|