C26H22O6 — CID 167007858
trans-(2R,3R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid (PubChem CID 167007858) has the molecular formula C26H22O6 and a molecular weight of 430.46 g/mol. Its IUPAC name is trans-(2R,3R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid.
| Compound Name | trans-(2R,3R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 167007858 |
| Molecular Formula | C26H22O6 |
| Molecular Weight | 430.46 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | trans-(2R,3R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2-methyl-4-phenylcyclobutane-1-carboxylic acid |
| SMILES | C[C@@H]1C(C(=O)O)C(c2ccccc2)[C@@H]1C(=O)Oc1ccccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C26H22O6/c1-15-22(25(27)28)24(16-7-3-2-4-8-16)23(15)26(29)32-19-10-6-5-9-18(19)17-11-12-20-21(13-17)31-14-30-20/h2-13,15,22-24H,14H2,1H3,(H,27,28)/t15-,22?,23-,24?/m1/s1 |
| InChIKey | ZGIJZFUUUHPBFN-MABQZBNFSA-N |
| XLogP | 4.74 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|