C33H28O8 — CID 163249776
(2R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid (PubChem CID 163249776) has the molecular formula C33H28O8 and a molecular weight of 552.58 g/mol. Its IUPAC name is (2R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid.
| Compound Name | (2R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 163249776 |
| Molecular Formula | C33H28O8 |
| Molecular Weight | 552.58 g/mol |
| Exact Mass | 552.18 |
| IUPAC Name | (2R)-3-[2-(1,3-benzodioxol-5-yl)phenoxy]carbonyl-2,4-bis(2-methoxyphenyl)cyclobutane-1-carboxylic acid |
| SMILES | COc1ccccc1C1C(C(=O)O)[C@@H](c2ccccc2OC)C1C(=O)Oc1ccccc1-c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C33H28O8/c1-37-23-12-6-4-10-21(23)28-30(32(34)35)29(22-11-5-7-13-24(22)38-2)31(28)33(36)41-25-14-8-3-9-20(25)19-15-16-26-27(17-19)40-18-39-26/h3-17,28-31H,18H2,1-2H3,(H,34,35)/t28-,29?,30?,31?/m1/s1 |
| InChIKey | RDXHYTCLUANGDC-QKHPIMKLSA-N |
| XLogP | 5.90 |
| TPSA | 100.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.58 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|