C27H22O4 — CID 145368265
naphthalen-1-yl (4R)-2,4-bis(4-hydroxyphenyl)cyclobutane-1-carboxylate (PubChem CID 145368265) has the molecular formula C27H22O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is naphthalen-1-yl (4R)-2,4-bis(4-hydroxyphenyl)cyclobutane-1-carboxylate.
| Compound Name | naphthalen-1-yl (4R)-2,4-bis(4-hydroxyphenyl)cyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 145368265 |
| Molecular Formula | C27H22O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | naphthalen-1-yl (4R)-2,4-bis(4-hydroxyphenyl)cyclobutane-1-carboxylate |
| SMILES | O=C(Oc1cccc2ccccc12)C1C(c2ccc(O)cc2)C[C@H]1c1ccc(O)cc1 |
| InChI | InChI=1S/C27H22O4/c28-20-12-8-18(9-13-20)23-16-24(19-10-14-21(29)15-11-19)26(23)27(30)31-25-7-3-5-17-4-1-2-6-22(17)25/h1-15,23-24,26,28-29H,16H2/t23-,24?,26?/m0/s1 |
| InChIKey | PNNMITFHCLGDAZ-JHUWLELGSA-N |
| XLogP | 5.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|