C17H25NO2 — CID 162061850
N,N-diethylformamide;1-[(1R,2S)-2-phenylcyclopropyl]propan-1-one (PubChem CID 162061850) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is N,N-diethylformamide;1-[(1R,2S)-2-phenylcyclopropyl]propan-1-one.
| Compound Name | N,N-diethylformamide;1-[(1R,2S)-2-phenylcyclopropyl]propan-1-one |
|---|---|
| PubChem CID | 162061850 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | N,N-diethylformamide;1-[(1R,2S)-2-phenylcyclopropyl]propan-1-one |
| SMILES | CCC(=O)[C@@H]1C[C@@H]1c1ccccc1.CCN(C=O)CC |
| InChI | InChI=1S/C12H14O.C5H11NO/c1-2-12(13)11-8-10(11)9-6-4-3-5-7-9;1-3-6(4-2)5-7/h3-7,10-11H,2,8H2,1H3;5H,3-4H2,1-2H3/t10-,11-;/m1./s1 |
| InChIKey | YZYHNBGGPNFTME-NDXYWBNTSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|