C20H19NO3 — CID 132918845
(3S,4R,5S)-4-nitro-3-phenyl-5-[(E)-2-phenylethenyl]cyclohexan-1-one (PubChem CID 132918845) has the molecular formula C20H19NO3 and a molecular weight of 321.38 g/mol. Its IUPAC name is (3S,4R,5S)-4-nitro-3-phenyl-5-[(E)-2-phenylethenyl]cyclohexan-1-one.
| Compound Name | (3S,4R,5S)-4-nitro-3-phenyl-5-[(E)-2-phenylethenyl]cyclohexan-1-one |
|---|---|
| PubChem CID | 132918845 |
| Molecular Formula | C20H19NO3 |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | (3S,4R,5S)-4-nitro-3-phenyl-5-[(E)-2-phenylethenyl]cyclohexan-1-one |
| SMILES | O=C1C[C@@H](/C=C/c2ccccc2)[C@@H]([N+](=O)[O-])[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C20H19NO3/c22-18-13-17(12-11-15-7-3-1-4-8-15)20(21(23)24)19(14-18)16-9-5-2-6-10-16/h1-12,17,19-20H,13-14H2/b12-11+/t17-,19+,20-/m1/s1 |
| InChIKey | FPOONURZBSCWCB-YNBUQLHZSA-N |
| XLogP | 4.11 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|