C14H24N2 — CID 91464467
(8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indole;ethane (PubChem CID 91464467) has the molecular formula C14H24N2 and a molecular weight of 220.36 g/mol. Its IUPAC name is (8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indole;ethane.
| Compound Name | (8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indole;ethane |
|---|---|
| PubChem CID | 91464467 |
| Molecular Formula | C14H24N2 |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.19 |
| IUPAC Name | (8bR)-1,2,3,3a,4,8b-hexahydropyrrolo[3,4-b]indole;ethane |
| SMILES | CC.CC.c1ccc2c(c1)NC1CNC[C@@H]21 |
| InChI | InChI=1S/C10H12N2.2C2H6/c1-2-4-9-7(3-1)8-5-11-6-10(8)12-9;2*1-2/h1-4,8,10-12H,5-6H2;2*1-2H3/t8-,10?;;/m0../s1 |
| InChIKey | RWBYSMMGUAYWSK-HKQLAKMDSA-N |
| XLogP | 3.22 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |