C12H16N2 — CID 18071403
9-methyl-2,3,3a,4,9,9a-hexahydro-1H-pyrrolo[3,4-b]quinoline (PubChem CID 18071403) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 9-methyl-2,3,3a,4,9,9a-hexahydro-1H-pyrrolo[3,4-b]quinoline.
| Compound Name | 9-methyl-2,3,3a,4,9,9a-hexahydro-1H-pyrrolo[3,4-b]quinoline |
|---|---|
| PubChem CID | 18071403 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 9-methyl-2,3,3a,4,9,9a-hexahydro-1H-pyrrolo[3,4-b]quinoline |
| SMILES | CC1c2ccccc2NC2CNCC21 |
| InChI | InChI=1S/C12H16N2/c1-8-9-4-2-3-5-11(9)14-12-7-13-6-10(8)12/h2-5,8,10,12-14H,6-7H2,1H3 |
| InChIKey | SRYYINZVICDDTK-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |