C18H18N2 — CID 102315493
(2aS,7aS)-spiro[2,2a,7,7a-tetrahydrocyclobuta[a]indene-1,2'-3,4-dihydro-1H-quinazoline] (PubChem CID 102315493) has the molecular formula C18H18N2 and a molecular weight of 262.36 g/mol. Its IUPAC name is (2aS,7aS)-spiro[2,2a,7,7a-tetrahydrocyclobuta[a]indene-1,2'-3,4-dihydro-1H-quinazoline].
| Compound Name | (2aS,7aS)-spiro[2,2a,7,7a-tetrahydrocyclobuta[a]indene-1,2'-3,4-dihydro-1H-quinazoline] |
|---|---|
| PubChem CID | 102315493 |
| Molecular Formula | C18H18N2 |
| Molecular Weight | 262.36 g/mol |
| Exact Mass | 262.15 |
| IUPAC Name | (2aS,7aS)-spiro[2,2a,7,7a-tetrahydrocyclobuta[a]indene-1,2'-3,4-dihydro-1H-quinazoline] |
| SMILES | c1ccc2c(c1)CNC1(C[C@@H]3c4ccccc4C[C@@H]31)N2 |
| InChI | InChI=1S/C18H18N2/c1-3-7-14-12(5-1)9-16-15(14)10-18(16)19-11-13-6-2-4-8-17(13)20-18/h1-8,15-16,19-20H,9-11H2/t15-,16+,18?/m1/s1 |
| InChIKey | KBHMLUKDZMFBME-LNKXUWQBSA-N |
| XLogP | 3.26 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |