C13H15N — CID 130765845
(1S)-tricyclo[7.3.1.02,7]trideca-2,4,6,10-tetraen-13-amine (PubChem CID 130765845) has the molecular formula C13H15N and a molecular weight of 185.27 g/mol. Its IUPAC name is (1S)-tricyclo[7.3.1.02,7]trideca-2,4,6,10-tetraen-13-amine.
| Compound Name | (1S)-tricyclo[7.3.1.02,7]trideca-2,4,6,10-tetraen-13-amine |
|---|---|
| PubChem CID | 130765845 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | (1S)-tricyclo[7.3.1.02,7]trideca-2,4,6,10-tetraen-13-amine |
| SMILES | NC1C2C=CC[C@H]1c1ccccc1C2 |
| InChI | InChI=1S/C13H15N/c14-13-10-5-3-7-12(13)11-6-2-1-4-9(11)8-10/h1-6,10,12-13H,7-8,14H2/t10?,12-,13?/m0/s1 |
| InChIKey | ATJGIYPCWKDOJS-YDGIUTOCSA-N |
| XLogP | 2.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|