C9H10ClN — CID 2794190
2-chloro-2,3-dihydro-1H-inden-1-amine (PubChem CID 2794190) has the molecular formula C9H10ClN and a molecular weight of 167.64 g/mol. Its IUPAC name is 2-chloro-2,3-dihydro-1H-inden-1-amine.
| Compound Name | 2-chloro-2,3-dihydro-1H-inden-1-amine |
|---|---|
| PubChem CID | 2794190 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 2-chloro-2,3-dihydro-1H-inden-1-amine |
| SMILES | NC1c2ccccc2CC1Cl |
| InChI | InChI=1S/C9H10ClN/c10-8-5-6-3-1-2-4-7(6)9(8)11/h1-4,8-9H,5,11H2 |
| InChIKey | PHUGLTBYXURQLG-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|