C9H12N2O — CID 144626033
N-(1-amino-2,3-dihydro-1H-inden-2-yl)hydroxylamine (PubChem CID 144626033) has the molecular formula C9H12N2O and a molecular weight of 164.21 g/mol. Its IUPAC name is N-(1-amino-2,3-dihydro-1H-inden-2-yl)hydroxylamine.
| Compound Name | N-(1-amino-2,3-dihydro-1H-inden-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 144626033 |
| Molecular Formula | C9H12N2O |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | N-(1-amino-2,3-dihydro-1H-inden-2-yl)hydroxylamine |
| SMILES | NC1c2ccccc2CC1NO |
| InChI | InChI=1S/C9H12N2O/c10-9-7-4-2-1-3-6(7)5-8(9)11-12/h1-4,8-9,11-12H,5,10H2 |
| InChIKey | QWGPKPBUDVMOIS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|