C12H16N2O2 — CID 166991162
N-[(1R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methoxyacetamide (PubChem CID 166991162) has the molecular formula C12H16N2O2 and a molecular weight of 220.27 g/mol. Its IUPAC name is N-[(1R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methoxyacetamide.
| Compound Name | N-[(1R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 166991162 |
| Molecular Formula | C12H16N2O2 |
| Molecular Weight | 220.27 g/mol |
| Exact Mass | 220.12 |
| IUPAC Name | N-[(1R)-1-amino-2,3-dihydro-1H-inden-2-yl]-2-methoxyacetamide |
| SMILES | COCC(=O)NC1Cc2ccccc2[C@H]1N |
| InChI | InChI=1S/C12H16N2O2/c1-16-7-11(15)14-10-6-8-4-2-3-5-9(8)12(10)13/h2-5,10,12H,6-7,13H2,1H3,(H,14,15)/t10?,12-/m1/s1 |
| InChIKey | UPHBTONZOOYAAD-TVKKRMFBSA-N |
| XLogP | 0.37 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.27 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |