C9H12N2O4 — CID 11435788
(1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol;nitric acid (PubChem CID 11435788) has the molecular formula C9H12N2O4 and a molecular weight of 212.21 g/mol. Its IUPAC name is (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol;nitric acid.
| Compound Name | (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol;nitric acid |
|---|---|
| PubChem CID | 11435788 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.21 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | (1R,2R)-1-amino-2,3-dihydro-1H-inden-2-ol;nitric acid |
| SMILES | N[C@@H]1c2ccccc2C[C@H]1O.O=[N+]([O-])O |
| InChI | InChI=1S/C9H11NO.HNO3/c10-9-7-4-2-1-3-6(7)5-8(9)11;2-1(3)4/h1-4,8-9,11H,5,10H2;(H,2,3,4)/t8-,9-;/m1./s1 |
| InChIKey | BJFHMUHQNWSHTL-VTLYIQCISA-N |
| XLogP | 0.26 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.21 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|