C17H25NO — CID 106781636
4-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline (PubChem CID 106781636) has the molecular formula C17H25NO and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 106781636 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | 4-(2,2,5,5-tetramethyloxolan-3-yl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CC1(C)CC(C2CCNc3ccccc32)C(C)(C)O1 |
| InChI | InChI=1S/C17H25NO/c1-16(2)11-14(17(3,4)19-16)12-9-10-18-15-8-6-5-7-13(12)15/h5-8,12,14,18H,9-11H2,1-4H3 |
| InChIKey | PBSHALRGDUYQMW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |