C16H16FN — CID 156636119
2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-quinoline (PubChem CID 156636119) has the molecular formula C16H16FN and a molecular weight of 241.31 g/mol. Its IUPAC name is 2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-quinoline.
| Compound Name | 2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-quinoline |
|---|---|
| PubChem CID | 156636119 |
| Molecular Formula | C16H16FN |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-(4-fluorophenyl)-2-methyl-3,4-dihydro-1H-quinoline |
| SMILES | CC1(c2ccc(F)cc2)CCc2ccccc2N1 |
| InChI | InChI=1S/C16H16FN/c1-16(13-6-8-14(17)9-7-13)11-10-12-4-2-3-5-15(12)18-16/h2-9,18H,10-11H2,1H3 |
| InChIKey | OMCHAYNIPGXHBY-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |