C15H10F2O — CID 145082433
1-(9,9-difluorofluoren-2-yl)ethanone (PubChem CID 145082433) has the molecular formula C15H10F2O and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(9,9-difluorofluoren-2-yl)ethanone.
| Compound Name | 1-(9,9-difluorofluoren-2-yl)ethanone |
|---|---|
| PubChem CID | 145082433 |
| Molecular Formula | C15H10F2O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(9,9-difluorofluoren-2-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(F)(F)c1ccccc1-2 |
| InChI | InChI=1S/C15H10F2O/c1-9(18)10-6-7-12-11-4-2-3-5-13(11)15(16,17)14(12)8-10/h2-8H,1H3 |
| InChIKey | ISPLKFSBXCJAFL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |