About 1-(9,9-difluorofluoren-2-yl)ethanone
1-(9,9-difluorofluoren-2-yl)ethanone (PubChem CID 145082433) has the molecular formula C15H10F2O
and a molecular weight of 244.24 g/mol. Its IUPAC name is 1-(9,9-difluorofluoren-2-yl)ethanone.
Molecular Properties
| Compound Name | 1-(9,9-difluorofluoren-2-yl)ethanone |
| PubChem CID | 145082433 |
| Molecular Formula | C15H10F2O |
| Molecular Weight | 244.24 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 1-(9,9-difluorofluoren-2-yl)ethanone |
| SMILES | CC(=O)c1ccc2c(c1)C(F)(F)c1ccccc1-2 |
| InChI | InChI=1S/C15H10F2O/c1-9(18)10-6-7-12-11-4-2-3-5-13(11)15(16,17)14(12)8-10/h2-8H,1H3 |
| InChIKey | ISPLKFSBXCJAFL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(9,9-difluorofluoren-2-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9,9-difluorofluoren-2-yl)ethanone?
The IUPAC name of 1-(9,9-difluorofluoren-2-yl)ethanone (CID 145082433) is 1-(9,9-difluorofluoren-2-yl)ethanone.
What is the SMILES notation for 1-(9,9-difluorofluoren-2-yl)ethanone?
The canonical SMILES for 1-(9,9-difluorofluoren-2-yl)ethanone is CC(=O)c1ccc2c(c1)C(F)(F)c1ccccc1-2.
What is the InChIKey of 1-(9,9-difluorofluoren-2-yl)ethanone?
The InChIKey is ISPLKFSBXCJAFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H10F2O/c1-9(18)10-6-7-12-11-4-2-3-5-13(11)15(16,17)14(12)8-10/h2-8H,1H3.
What are the key properties of 1-(9,9-difluorofluoren-2-yl)ethanone?
1-(9,9-difluorofluoren-2-yl)ethanone has a molecular weight of 244.24 g/mol, XLogP of 4.01, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9,9-difluorofluoren-2-yl)ethanone is sourced from PubChem (CID 145082433), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).