About 2'-fluorospiro[cyclohexane-1,9'-fluorene]
2'-fluorospiro[cyclohexane-1,9'-fluorene] (PubChem CID 18740734) has the molecular formula C18H17F
and a molecular weight of 252.33 g/mol. Its IUPAC name is 2'-fluorospiro[cyclohexane-1,9'-fluorene].
Molecular Properties
| Compound Name | 2'-fluorospiro[cyclohexane-1,9'-fluorene] |
| PubChem CID | 18740734 |
| Molecular Formula | C18H17F |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2'-fluorospiro[cyclohexane-1,9'-fluorene] |
| SMILES | Fc1ccc2c(c1)C1(CCCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C18H17F/c19-13-8-9-15-14-6-2-3-7-16(14)18(17(15)12-13)10-4-1-5-11-18/h2-3,6-9,12H,1,4-5,10-11H2 |
| InChIKey | YTIKUJIENUTVGY-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2'-fluorospiro[cyclohexane-1,9'-fluorene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-fluorospiro[cyclohexane-1,9'-fluorene]?
The IUPAC name of 2'-fluorospiro[cyclohexane-1,9'-fluorene] (CID 18740734) is 2'-fluorospiro[cyclohexane-1,9'-fluorene].
What is the SMILES notation for 2'-fluorospiro[cyclohexane-1,9'-fluorene]?
The canonical SMILES for 2'-fluorospiro[cyclohexane-1,9'-fluorene] is Fc1ccc2c(c1)C1(CCCCC1)c1ccccc1-2.
What is the InChIKey of 2'-fluorospiro[cyclohexane-1,9'-fluorene]?
The InChIKey is YTIKUJIENUTVGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H17F/c19-13-8-9-15-14-6-2-3-7-16(14)18(17(15)12-13)10-4-1-5-11-18/h2-3,6-9,12H,1,4-5,10-11H2.
What are the key properties of 2'-fluorospiro[cyclohexane-1,9'-fluorene]?
2'-fluorospiro[cyclohexane-1,9'-fluorene] has a molecular weight of 252.33 g/mol, XLogP of 5.06, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-fluorospiro[cyclohexane-1,9'-fluorene] is sourced from PubChem (CID 18740734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).