About 9,9'-Bifluorene
9,9'-Bifluorene (PubChem CID 137063) has the molecular formula C26H18
and a molecular weight of 330.40 g/mol. Its IUPAC name is 9-(9H-fluoren-9-yl)-9H-fluorene.
Molecular Properties
| Compound Name | 9,9'-Bifluorene |
| PubChem CID | 137063 |
| Molecular Formula | C26H18 |
| Molecular Weight | 330.40 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 9-(9H-fluoren-9-yl)-9H-fluorene |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)C4C5=CC=CC=C5C6=CC=CC=C46 |
| InChI | InChI=1S/C26H18/c1-5-13-21-17(9-1)18-10-2-6-14-22(18)25(21)26-23-15-7-3-11-19(23)20-12-4-8-16-24(20)26/h1-16,25-26H |
| InChIKey | QXAIDADUIMVTPS-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | 418 |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.40 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 9,9'-Bifluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,9'-Bifluorene?
The IUPAC name of 9,9'-Bifluorene (CID 137063) is 9-(9H-fluoren-9-yl)-9H-fluorene.
What is the SMILES notation for 9,9'-Bifluorene?
The canonical SMILES for 9,9'-Bifluorene is C1=CC=C2C(=C1)C(C3=CC=CC=C32)C4C5=CC=CC=C5C6=CC=CC=C46.
What is the InChIKey of 9,9'-Bifluorene?
The InChIKey is QXAIDADUIMVTPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H18/c1-5-13-21-17(9-1)18-10-2-6-14-22(18)25(21)26-23-15-7-3-11-19(23)20-12-4-8-16-24(20)26/h1-16,25-26H.
What are the key properties of 9,9'-Bifluorene?
9,9'-Bifluorene has a molecular weight of 330.40 g/mol, XLogP of 6.50, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,9'-Bifluorene is sourced from PubChem (CID 137063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).