C23H27I — CID 89170477
(2Z)-2-[(E,2E)-2-ethylidene-6-iodo-3-methylideneoct-6-enylidene]-1,1-dimethyl-3-methylideneindene (PubChem CID 89170477) has the molecular formula C23H27I and a molecular weight of 430.37 g/mol. Its IUPAC name is (2Z)-2-[(E,2E)-2-ethylidene-6-iodo-3-methylideneoct-6-enylidene]-1,1-dimethyl-3-methylideneindene.
| Compound Name | (2Z)-2-[(E,2E)-2-ethylidene-6-iodo-3-methylideneoct-6-enylidene]-1,1-dimethyl-3-methylideneindene |
|---|---|
| PubChem CID | 89170477 |
| Molecular Formula | C23H27I |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.12 |
| IUPAC Name | (2Z)-2-[(E,2E)-2-ethylidene-6-iodo-3-methylideneoct-6-enylidene]-1,1-dimethyl-3-methylideneindene |
| SMILES | C=C(CC/C(I)=C\C)C(/C=C1\C(=C)c2ccccc2C1(C)C)=C/C |
| InChI | InChI=1S/C23H27I/c1-7-18(16(3)13-14-19(24)8-2)15-22-17(4)20-11-9-10-12-21(20)23(22,5)6/h7-12,15H,3-4,13-14H2,1-2,5-6H3/b18-7+,19-8+,22-15+ |
| InChIKey | QTSMZLHLAFUBLY-SHKGIAMESA-N |
| XLogP | 7.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 7.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|