C21H24O — CID 153369649
3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;methoxymethane (PubChem CID 153369649) has the molecular formula C21H24O and a molecular weight of 292.42 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;methoxymethane.
| Compound Name | 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;methoxymethane |
|---|---|
| PubChem CID | 153369649 |
| Molecular Formula | C21H24O |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;methoxymethane |
| SMILES | C=CC(=C)c1ccc2c(c1)-c1ccccc1C2(C)C.COC |
| InChI | InChI=1S/C19H18.C2H6O/c1-5-13(2)14-10-11-18-16(12-14)15-8-6-7-9-17(15)19(18,3)4;1-3-2/h5-12H,1-2H2,3-4H3;1-2H3 |
| InChIKey | QGNSSDXZZSOYTC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|