C29H28S — CID 153368961
3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;2,4-dimethyl-1-benzothiophene (PubChem CID 153368961) has the molecular formula C29H28S and a molecular weight of 408.61 g/mol. Its IUPAC name is 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;2,4-dimethyl-1-benzothiophene.
| Compound Name | 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;2,4-dimethyl-1-benzothiophene |
|---|---|
| PubChem CID | 153368961 |
| Molecular Formula | C29H28S |
| Molecular Weight | 408.61 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | 3-buta-1,3-dien-2-yl-9,9-dimethylfluorene;2,4-dimethyl-1-benzothiophene |
| SMILES | C=CC(=C)c1ccc2c(c1)-c1ccccc1C2(C)C.Cc1cc2c(C)cccc2s1 |
| InChI | InChI=1S/C19H18.C10H10S/c1-5-13(2)14-10-11-18-16(12-14)15-8-6-7-9-17(15)19(18,3)4;1-7-4-3-5-10-9(7)6-8(2)11-10/h5-12H,1-2H2,3-4H3;3-6H,1-2H3 |
| InChIKey | HIGGSDOKPIEUEU-UHFFFAOYSA-N |
| XLogP | 8.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.61 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|