C19H19N — CID 135227648
N-buta-1,3-dien-2-yl-9,9-dimethylfluoren-3-amine (PubChem CID 135227648) has the molecular formula C19H19N and a molecular weight of 261.37 g/mol. Its IUPAC name is N-buta-1,3-dien-2-yl-9,9-dimethylfluoren-3-amine.
| Compound Name | N-buta-1,3-dien-2-yl-9,9-dimethylfluoren-3-amine |
|---|---|
| PubChem CID | 135227648 |
| Molecular Formula | C19H19N |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-buta-1,3-dien-2-yl-9,9-dimethylfluoren-3-amine |
| SMILES | C=CC(=C)Nc1ccc2c(c1)-c1ccccc1C2(C)C |
| InChI | InChI=1S/C19H19N/c1-5-13(2)20-14-10-11-18-16(12-14)15-8-6-7-9-17(15)19(18,3)4/h5-12,20H,1-2H2,3-4H3 |
| InChIKey | MMIMHPYIYCATNQ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|