C51H42N6O6 — CID 156756835
1-N,3-N,5-N-tris(9,9-dimethylfluoren-3-yl)-2,4,6-trinitrobenzene-1,3,5-triamine (PubChem CID 156756835) has the molecular formula C51H42N6O6 and a molecular weight of 834.93 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(9,9-dimethylfluoren-3-yl)-2,4,6-trinitrobenzene-1,3,5-triamine.
| Compound Name | 1-N,3-N,5-N-tris(9,9-dimethylfluoren-3-yl)-2,4,6-trinitrobenzene-1,3,5-triamine |
|---|---|
| PubChem CID | 156756835 |
| Molecular Formula | C51H42N6O6 |
| Molecular Weight | 834.93 g/mol |
| Exact Mass | 834.32 |
| IUPAC Name | 1-N,3-N,5-N-tris(9,9-dimethylfluoren-3-yl)-2,4,6-trinitrobenzene-1,3,5-triamine |
| SMILES | CC1(C)c2ccccc2-c2cc(Nc3c([N+](=O)[O-])c(Nc4ccc5c(c4)-c4ccccc4C5(C)C)c([N+](=O)[O-])c(Nc4ccc5c(c4)-c4ccccc4C5(C)C)c3[N+](=O)[O-])ccc21 |
| InChI | InChI=1S/C51H42N6O6/c1-49(2)37-16-10-7-13-31(37)34-25-28(19-22-40(34)49)52-43-46(55(58)59)44(53-29-20-23-41-35(26-29)32-14-8-11-17-38(32)50(41,3)4)48(57(62)63)45(47(43)56(60)61)54-30-21-24-42-36(27-30)33-15-9-12-18-39(33)51(42,5)6/h7-27,52-54H,1-6H3 |
| InChIKey | AQGJQFSUODJHFF-UHFFFAOYSA-N |
| XLogP | 13.56 |
| TPSA | 165.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.93 |
| LogP ≤ 5 | 13.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|