About 3-[(E)-but-2-enyl]-1,1-dimethylindene
3-[(E)-but-2-enyl]-1,1-dimethylindene (PubChem CID 174296931) has the molecular formula C15H18
and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-1,1-dimethylindene.
Molecular Properties
| Compound Name | 3-[(E)-but-2-enyl]-1,1-dimethylindene |
| PubChem CID | 174296931 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-[(E)-but-2-enyl]-1,1-dimethylindene |
| SMILES | C/C=C/CC1=CC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H18/c1-4-5-8-12-11-15(2,3)14-10-7-6-9-13(12)14/h4-7,9-11H,8H2,1-3H3/b5-4+ |
| InChIKey | FPHVDTXJOCSZBS-SNAWJCMRSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(E)-but-2-enyl]-1,1-dimethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(E)-but-2-enyl]-1,1-dimethylindene?
The IUPAC name of 3-[(E)-but-2-enyl]-1,1-dimethylindene (CID 174296931) is 3-[(E)-but-2-enyl]-1,1-dimethylindene.
What is the SMILES notation for 3-[(E)-but-2-enyl]-1,1-dimethylindene?
The canonical SMILES for 3-[(E)-but-2-enyl]-1,1-dimethylindene is C/C=C/CC1=CC(C)(C)c2ccccc21.
What is the InChIKey of 3-[(E)-but-2-enyl]-1,1-dimethylindene?
The InChIKey is FPHVDTXJOCSZBS-SNAWJCMRSA-N. The full InChI is InChI=1S/C15H18/c1-4-5-8-12-11-15(2,3)14-10-7-6-9-13(12)14/h4-7,9-11H,8H2,1-3H3/b5-4+.
What are the key properties of 3-[(E)-but-2-enyl]-1,1-dimethylindene?
3-[(E)-but-2-enyl]-1,1-dimethylindene has a molecular weight of 198.31 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(E)-but-2-enyl]-1,1-dimethylindene is sourced from PubChem (CID 174296931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).