C15H18 — CID 174296931
3-[(E)-but-2-enyl]-1,1-dimethylindene (PubChem CID 174296931) has the molecular formula C15H18 and a molecular weight of 198.31 g/mol. Its IUPAC name is 3-[(E)-but-2-enyl]-1,1-dimethylindene.
| Compound Name | 3-[(E)-but-2-enyl]-1,1-dimethylindene |
|---|---|
| PubChem CID | 174296931 |
| Molecular Formula | C15H18 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.14 |
| IUPAC Name | 3-[(E)-but-2-enyl]-1,1-dimethylindene |
| SMILES | C/C=C/CC1=CC(C)(C)c2ccccc21 |
| InChI | InChI=1S/C15H18/c1-4-5-8-12-11-15(2,3)14-10-7-6-9-13(12)14/h4-7,9-11H,8H2,1-3H3/b5-4+ |
| InChIKey | FPHVDTXJOCSZBS-SNAWJCMRSA-N |
| XLogP | 4.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|