C11H11Cl — CID 154967780
3-chloro-1,1-dimethylindene (PubChem CID 154967780) has the molecular formula C11H11Cl and a molecular weight of 178.66 g/mol. Its IUPAC name is 3-chloro-1,1-dimethylindene.
| Compound Name | 3-chloro-1,1-dimethylindene |
|---|---|
| PubChem CID | 154967780 |
| Molecular Formula | C11H11Cl |
| Molecular Weight | 178.66 g/mol |
| Exact Mass | 178.05 |
| IUPAC Name | 3-chloro-1,1-dimethylindene |
| SMILES | CC1(C)C=C(Cl)c2ccccc21 |
| InChI | InChI=1S/C11H11Cl/c1-11(2)7-10(12)8-5-3-4-6-9(8)11/h3-7H,1-2H3 |
| InChIKey | BUQRAROKFMIDQN-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.66 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |