C14H18O — CID 172794366
1,1,4,4-tetramethylnaphthalen-2-ol (PubChem CID 172794366) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is 1,1,4,4-tetramethylnaphthalen-2-ol.
| Compound Name | 1,1,4,4-tetramethylnaphthalen-2-ol |
|---|---|
| PubChem CID | 172794366 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | 1,1,4,4-tetramethylnaphthalen-2-ol |
| SMILES | CC1(C)C=C(O)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C14H18O/c1-13(2)9-12(15)14(3,4)11-8-6-5-7-10(11)13/h5-9,15H,1-4H3 |
| InChIKey | PZQXJTNOVKWEBE-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |