About 2-diazo-1,1,3,3-tetramethylindene
2-diazo-1,1,3,3-tetramethylindene (PubChem CID 12732507) has the molecular formula C13H16N2
and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-diazo-1,1,3,3-tetramethylindene.
Molecular Properties
| Compound Name | 2-diazo-1,1,3,3-tetramethylindene |
| PubChem CID | 12732507 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-diazo-1,1,3,3-tetramethylindene |
| SMILES | CC1(C)C(=[N+]=[N-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H16N2/c1-12(2)9-7-5-6-8-10(9)13(3,4)11(12)15-14/h5-8H,1-4H3 |
| InChIKey | DFDDJQCOYHJOMA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 2-diazo-1,1,3,3-tetramethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-diazo-1,1,3,3-tetramethylindene?
The IUPAC name of 2-diazo-1,1,3,3-tetramethylindene (CID 12732507) is 2-diazo-1,1,3,3-tetramethylindene.
What is the SMILES notation for 2-diazo-1,1,3,3-tetramethylindene?
The canonical SMILES for 2-diazo-1,1,3,3-tetramethylindene is CC1(C)C(=[N+]=[N-])C(C)(C)c2ccccc21.
What is the InChIKey of 2-diazo-1,1,3,3-tetramethylindene?
The InChIKey is DFDDJQCOYHJOMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16N2/c1-12(2)9-7-5-6-8-10(9)13(3,4)11(12)15-14/h5-8H,1-4H3.
What are the key properties of 2-diazo-1,1,3,3-tetramethylindene?
2-diazo-1,1,3,3-tetramethylindene has a molecular weight of 200.28 g/mol, XLogP of 2.93, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-diazo-1,1,3,3-tetramethylindene is sourced from PubChem (CID 12732507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).