C13H16N2 — CID 12732507
2-diazo-1,1,3,3-tetramethylindene (PubChem CID 12732507) has the molecular formula C13H16N2 and a molecular weight of 200.28 g/mol. Its IUPAC name is 2-diazo-1,1,3,3-tetramethylindene.
| Compound Name | 2-diazo-1,1,3,3-tetramethylindene |
|---|---|
| PubChem CID | 12732507 |
| Molecular Formula | C13H16N2 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.13 |
| IUPAC Name | 2-diazo-1,1,3,3-tetramethylindene |
| SMILES | CC1(C)C(=[N+]=[N-])C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C13H16N2/c1-12(2)9-7-5-6-8-10(9)13(3,4)11(12)15-14/h5-8H,1-4H3 |
| InChIKey | DFDDJQCOYHJOMA-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 36.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|