C28H34 — CID 16754491
2-[1,2-dideuterio-2-(1,1,3,3-tetramethylinden-2-ylidene)ethylidene]-1,1,3,3-tetramethylindene (PubChem CID 16754491) has the molecular formula C28H34 and a molecular weight of 372.59 g/mol. Its IUPAC name is 2-[1,2-dideuterio-2-(1,1,3,3-tetramethylinden-2-ylidene)ethylidene]-1,1,3,3-tetramethylindene.
| Compound Name | 2-[1,2-dideuterio-2-(1,1,3,3-tetramethylinden-2-ylidene)ethylidene]-1,1,3,3-tetramethylindene |
|---|---|
| PubChem CID | 16754491 |
| Molecular Formula | C28H34 |
| Molecular Weight | 372.59 g/mol |
| Exact Mass | 372.28 |
| IUPAC Name | 2-[1,2-dideuterio-2-(1,1,3,3-tetramethylinden-2-ylidene)ethylidene]-1,1,3,3-tetramethylindene |
| SMILES | [2H]C(C([2H])=C1C(C)(C)c2ccccc2C1(C)C)=C1C(C)(C)c2ccccc2C1(C)C |
| InChI | InChI=1S/C28H34/c1-25(2)19-13-9-10-14-20(19)26(3,4)23(25)17-18-24-27(5,6)21-15-11-12-16-22(21)28(24,7)8/h9-18H,1-8H3/i17D,18D |
| InChIKey | ILUKBWPHPHJFRJ-IUKNHUCNSA-N |
| XLogP | 7.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.59 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |