C12H16ClN — CID 12524874
1,2,3,3-tetramethylindol-1-ium chloride (PubChem CID 12524874) has the molecular formula C12H16ClN and a molecular weight of 209.72 g/mol. Its IUPAC name is 1,2,3,3-tetramethylindol-1-ium chloride.
| Compound Name | 1,2,3,3-tetramethylindol-1-ium chloride |
|---|---|
| PubChem CID | 12524874 |
| Molecular Formula | C12H16ClN |
| Molecular Weight | 209.72 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 1,2,3,3-tetramethylindol-1-ium chloride |
| SMILES | CC1=[N+](C)c2ccccc2C1(C)C.[Cl-] |
| InChI | InChI=1S/C12H16N.ClH/c1-9-12(2,3)10-7-5-6-8-11(10)13(9)4;/h5-8H,1-4H3;1H/q+1;/p-1 |
| InChIKey | GXQHIKHECXFUOE-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.72 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|