C12H12O2 — CID 82075339
3,3-dimethylindene-1-carboxylic acid (PubChem CID 82075339) has the molecular formula C12H12O2 and a molecular weight of 188.23 g/mol. Its IUPAC name is 3,3-dimethylindene-1-carboxylic acid.
| Compound Name | 3,3-dimethylindene-1-carboxylic acid |
|---|---|
| PubChem CID | 82075339 |
| Molecular Formula | C12H12O2 |
| Molecular Weight | 188.23 g/mol |
| Exact Mass | 188.08 |
| IUPAC Name | 3,3-dimethylindene-1-carboxylic acid |
| SMILES | CC1(C)C=C(C(=O)O)c2ccccc21 |
| InChI | InChI=1S/C12H12O2/c1-12(2)7-9(11(13)14)8-5-3-4-6-10(8)12/h3-7H,1-2H3,(H,13,14) |
| InChIKey | AQRDILWKNASMED-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.23 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |