C21H25N — CID 176909430
N-(4-tert-butylphenyl)-3,3-dimethylinden-1-amine (PubChem CID 176909430) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-3,3-dimethylinden-1-amine.
| Compound Name | N-(4-tert-butylphenyl)-3,3-dimethylinden-1-amine |
|---|---|
| PubChem CID | 176909430 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N-(4-tert-butylphenyl)-3,3-dimethylinden-1-amine |
| SMILES | CC(C)(C)c1ccc(NC2=CC(C)(C)c3ccccc32)cc1 |
| InChI | InChI=1S/C21H25N/c1-20(2,3)15-10-12-16(13-11-15)22-19-14-21(4,5)18-9-7-6-8-17(18)19/h6-14,22H,1-5H3 |
| InChIKey | SLBXAZSUHHCVMN-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |