About 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene
3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene (PubChem CID 126718482) has the molecular formula C19H17Br
and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene.
Molecular Properties
| Compound Name | 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene |
| PubChem CID | 126718482 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene |
| SMILES | CC1(C)C=C(/C=C\c2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H17Br/c1-19(2)13-15(17-5-3-4-6-18(17)19)10-7-14-8-11-16(20)12-9-14/h3-13H,1-2H3/b10-7- |
| InChIKey | BZFRHKCQNMBUFX-YFHOEESVSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene?
The IUPAC name of 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene (CID 126718482) is 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene.
What is the SMILES notation for 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene?
The canonical SMILES for 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene is CC1(C)C=C(/C=C\c2ccc(Br)cc2)c2ccccc21.
What is the InChIKey of 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene?
The InChIKey is BZFRHKCQNMBUFX-YFHOEESVSA-N. The full InChI is InChI=1S/C19H17Br/c1-19(2)13-15(17-5-3-4-6-18(17)19)10-7-14-8-11-16(20)12-9-14/h3-13H,1-2H3/b10-7-.
What are the key properties of 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene?
3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene has a molecular weight of 325.25 g/mol, XLogP of 5.84, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene is sourced from PubChem (CID 126718482), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).