C19H17Br — CID 126718482
3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene (PubChem CID 126718482) has the molecular formula C19H17Br and a molecular weight of 325.25 g/mol. Its IUPAC name is 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene.
| Compound Name | 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene |
|---|---|
| PubChem CID | 126718482 |
| Molecular Formula | C19H17Br |
| Molecular Weight | 325.25 g/mol |
| Exact Mass | 324.05 |
| IUPAC Name | 3-[(Z)-2-(4-bromophenyl)ethenyl]-1,1-dimethylindene |
| SMILES | CC1(C)C=C(/C=C\c2ccc(Br)cc2)c2ccccc21 |
| InChI | InChI=1S/C19H17Br/c1-19(2)13-15(17-5-3-4-6-18(17)19)10-7-14-8-11-16(20)12-9-14/h3-13H,1-2H3/b10-7- |
| InChIKey | BZFRHKCQNMBUFX-YFHOEESVSA-N |
| XLogP | 5.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.25 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |