C34H28 — CID 134848562
9-ethenyl-2-[(E)-2-(9-ethenyl-9-methylfluoren-2-yl)ethenyl]-9-methylfluorene (PubChem CID 134848562) has the molecular formula C34H28 and a molecular weight of 436.60 g/mol. Its IUPAC name is 9-ethenyl-2-[(E)-2-(9-ethenyl-9-methylfluoren-2-yl)ethenyl]-9-methylfluorene.
| Compound Name | 9-ethenyl-2-[(E)-2-(9-ethenyl-9-methylfluoren-2-yl)ethenyl]-9-methylfluorene |
|---|---|
| PubChem CID | 134848562 |
| Molecular Formula | C34H28 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | 9-ethenyl-2-[(E)-2-(9-ethenyl-9-methylfluoren-2-yl)ethenyl]-9-methylfluorene |
| SMILES | C=CC1(C)c2ccccc2-c2ccc(/C=C/c3ccc4c(c3)C(C)(C=C)c3ccccc3-4)cc21 |
| InChI | InChI=1S/C34H28/c1-5-33(3)29-13-9-7-11-25(29)27-19-17-23(21-31(27)33)15-16-24-18-20-28-26-12-8-10-14-30(26)34(4,6-2)32(28)22-24/h5-22H,1-2H2,3-4H3/b16-15+ |
| InChIKey | BQMRQWURSBGHRU-FOCLMDBBSA-N |
| XLogP | 8.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|