C49H41N — CID 123223191
9-[9,9-dimethyl-7-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]fluoren-2-yl]carbazole (PubChem CID 123223191) has the molecular formula C49H41N and a molecular weight of 643.87 g/mol. Its IUPAC name is 9-[9,9-dimethyl-7-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]fluoren-2-yl]carbazole.
| Compound Name | 9-[9,9-dimethyl-7-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]fluoren-2-yl]carbazole |
|---|---|
| PubChem CID | 123223191 |
| Molecular Formula | C49H41N |
| Molecular Weight | 643.87 g/mol |
| Exact Mass | 643.32 |
| IUPAC Name | 9-[9,9-dimethyl-7-[2-(5,5,10,10-tetramethylindeno[2,1-a]inden-2-yl)ethenyl]fluoren-2-yl]carbazole |
| SMILES | CC1(C)C2=C(c3ccccc31)C(C)(C)c1cc(C=Cc3ccc4c(c3)C(C)(C)c3cc(-n5c6ccccc6c6ccccc65)ccc3-4)ccc12 |
| InChI | InChI=1S/C49H41N/c1-47(2)40-27-30(19-20-31-22-25-38-41(28-31)49(5,6)45-37-15-7-10-16-39(37)48(3,4)46(38)45)21-24-33(40)34-26-23-32(29-42(34)47)50-43-17-11-8-13-35(43)36-14-9-12-18-44(36)50/h7-29H,1-6H3 |
| InChIKey | WVCQPSBXPVOJSH-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.87 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|