C13H16O — CID 116659873
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)pent-4-en-2-ol (PubChem CID 116659873) has the molecular formula C13H16O and a molecular weight of 188.27 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)pent-4-en-2-ol.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)pent-4-en-2-ol |
|---|---|
| PubChem CID | 116659873 |
| Molecular Formula | C13H16O |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)pent-4-en-2-ol |
| SMILES | C=CCC(O)CC1Cc2ccccc21 |
| InChI | InChI=1S/C13H16O/c1-2-5-12(14)9-11-8-10-6-3-4-7-13(10)11/h2-4,6-7,11-12,14H,1,5,8-9H2 |
| InChIKey | RBPBDUPUJWVONF-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|