C15H22O — CID 115816723
1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-ethylpentan-2-ol (PubChem CID 115816723) has the molecular formula C15H22O and a molecular weight of 218.34 g/mol. Its IUPAC name is 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-ethylpentan-2-ol.
| Compound Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-ethylpentan-2-ol |
|---|---|
| PubChem CID | 115816723 |
| Molecular Formula | C15H22O |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | 1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)-3-ethylpentan-2-ol |
| SMILES | CCC(CC)C(O)CC1Cc2ccccc21 |
| InChI | InChI=1S/C15H22O/c1-3-11(4-2)15(16)10-13-9-12-7-5-6-8-14(12)13/h5-8,11,13,15-16H,3-4,9-10H2,1-2H3 |
| InChIKey | GRRAYXYQDJYLPO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |