About 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid (PubChem CID 79425221) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid.
Analyze 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid?
The IUPAC name of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid (CID 79425221) is 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid.
What is the SMILES notation for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid?
The canonical SMILES for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid is CCC(CC1Cc2ccccc21)C(=O)O.
What is the InChIKey of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid?
The InChIKey is CCXQILFJQYGFHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-2-9(13(14)15)7-11-8-10-5-3-4-6-12(10)11/h3-6,9,11H,2,7-8H2,1H3,(H,14,15).
What are the key properties of 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid?
2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid has a molecular weight of 204.27 g/mol, XLogP of 2.83, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-bicyclo[4.2.0]octa-1,3,5-trienylmethyl)butanoic acid is sourced from PubChem (CID 79425221), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).