C14H16O — CID 103454263
(E)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-3-en-2-one (PubChem CID 103454263) has the molecular formula C14H16O and a molecular weight of 200.28 g/mol. Its IUPAC name is (E)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-3-en-2-one.
| Compound Name | (E)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-3-en-2-one |
|---|---|
| PubChem CID | 103454263 |
| Molecular Formula | C14H16O |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | (E)-1-(7-bicyclo[4.2.0]octa-1,3,5-trienyl)hex-3-en-2-one |
| SMILES | CC/C=C/C(=O)CC1Cc2ccccc21 |
| InChI | InChI=1S/C14H16O/c1-2-3-7-13(15)10-12-9-11-6-4-5-8-14(11)12/h3-8,12H,2,9-10H2,1H3/b7-3+ |
| InChIKey | XCDHBLAKICALFV-XVNBXDOJSA-N |
| XLogP | 3.25 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|