C21H24N+ — CID 101397838
(17S)-9-[(E)-but-2-enyl]-17-methyl-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene (PubChem CID 101397838) has the molecular formula C21H24N+ and a molecular weight of 290.43 g/mol. Its IUPAC name is (17S)-9-[(E)-but-2-enyl]-17-methyl-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene.
| Compound Name | (17S)-9-[(E)-but-2-enyl]-17-methyl-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene |
|---|---|
| PubChem CID | 101397838 |
| Molecular Formula | C21H24N+ |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.19 |
| IUPAC Name | (17S)-9-[(E)-but-2-enyl]-17-methyl-9-azoniatetracyclo[7.7.1.02,7.011,16]heptadeca-2,4,6,11,13,15-hexaene |
| SMILES | C/C=C/C[N+]12Cc3ccccc3C(c3ccccc3C1)[C@@H]2C |
| InChI | InChI=1S/C21H24N/c1-3-4-13-22-14-17-9-5-7-11-19(17)21(16(22)2)20-12-8-6-10-18(20)15-22/h3-12,16,21H,13-15H2,1-2H3/q+1/b4-3+/t16-,21?,22?/m0/s1 |
| InChIKey | LBTQHNSEZMHFKB-XJRVNPQNSA-N |
| XLogP | 4.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|