C13H17NO2 — CID 19892826
3-ethenyl-1,2,3,4-tetrahydronaphthalen-1-ol;formamide (PubChem CID 19892826) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 3-ethenyl-1,2,3,4-tetrahydronaphthalen-1-ol;formamide.
| Compound Name | 3-ethenyl-1,2,3,4-tetrahydronaphthalen-1-ol;formamide |
|---|---|
| PubChem CID | 19892826 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 3-ethenyl-1,2,3,4-tetrahydronaphthalen-1-ol;formamide |
| SMILES | C=CC1Cc2ccccc2C(O)C1.NC=O |
| InChI | InChI=1S/C12H14O.CH3NO/c1-2-9-7-10-5-3-4-6-11(10)12(13)8-9;2-1-3/h2-6,9,12-13H,1,7-8H2;1H,(H2,2,3) |
| InChIKey | APCHGFJMUZSGCZ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|