C10H11NO2 — CID 12523054
4-hydroxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde (PubChem CID 12523054) has the molecular formula C10H11NO2 and a molecular weight of 177.20 g/mol. Its IUPAC name is 4-hydroxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde.
| Compound Name | 4-hydroxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
|---|---|
| PubChem CID | 12523054 |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.08 |
| IUPAC Name | 4-hydroxy-3,4-dihydro-1H-isoquinoline-2-carbaldehyde |
| SMILES | O=CN1Cc2ccccc2C(O)C1 |
| InChI | InChI=1S/C10H11NO2/c12-7-11-5-8-3-1-2-4-9(8)10(13)6-11/h1-4,7,10,13H,5-6H2 |
| InChIKey | PEWBMGZIQPRIGW-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|