C10H8INO2 — CID 174998232
2-(2-iodo-1,3-dihydroisoindol-1-yl)-2-oxoacetaldehyde (PubChem CID 174998232) has the molecular formula C10H8INO2 and a molecular weight of 301.08 g/mol. Its IUPAC name is 2-(2-iodo-1,3-dihydroisoindol-1-yl)-2-oxoacetaldehyde.
| Compound Name | 2-(2-iodo-1,3-dihydroisoindol-1-yl)-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174998232 |
| Molecular Formula | C10H8INO2 |
| Molecular Weight | 301.08 g/mol |
| Exact Mass | 300.96 |
| IUPAC Name | 2-(2-iodo-1,3-dihydroisoindol-1-yl)-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1c2ccccc2CN1I |
| InChI | InChI=1S/C10H8INO2/c11-12-5-7-3-1-2-4-8(7)10(12)9(14)6-13/h1-4,6,10H,5H2 |
| InChIKey | FPNKHPOMCONCBF-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.08 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|