C13H14BrNO2 — CID 174635800
2-[2-(3-bromopropyl)-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 174635800) has the molecular formula C13H14BrNO2 and a molecular weight of 296.16 g/mol. Its IUPAC name is 2-[2-(3-bromopropyl)-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-(3-bromopropyl)-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174635800 |
| Molecular Formula | C13H14BrNO2 |
| Molecular Weight | 296.16 g/mol |
| Exact Mass | 295.02 |
| IUPAC Name | 2-[2-(3-bromopropyl)-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | O=CC(=O)C1c2ccccc2CN1CCCBr |
| InChI | InChI=1S/C13H14BrNO2/c14-6-3-7-15-8-10-4-1-2-5-11(10)13(15)12(17)9-16/h1-2,4-5,9,13H,3,6-8H2 |
| InChIKey | UZFPNQUMYPYUHV-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.16 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|