C25H19ClN4O2 — CID 174594817
2-[2-[[5-amino-3-(2-chlorophenyl)quinoxalin-2-yl]methyl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde (PubChem CID 174594817) has the molecular formula C25H19ClN4O2 and a molecular weight of 442.91 g/mol. Its IUPAC name is 2-[2-[[5-amino-3-(2-chlorophenyl)quinoxalin-2-yl]methyl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde.
| Compound Name | 2-[2-[[5-amino-3-(2-chlorophenyl)quinoxalin-2-yl]methyl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
|---|---|
| PubChem CID | 174594817 |
| Molecular Formula | C25H19ClN4O2 |
| Molecular Weight | 442.91 g/mol |
| Exact Mass | 442.12 |
| IUPAC Name | 2-[2-[[5-amino-3-(2-chlorophenyl)quinoxalin-2-yl]methyl]-1,3-dihydroisoindol-1-yl]-2-oxoacetaldehyde |
| SMILES | Nc1cccc2nc(CN3Cc4ccccc4C3C(=O)C=O)c(-c3ccccc3Cl)nc12 |
| InChI | InChI=1S/C25H19ClN4O2/c26-18-9-4-3-8-17(18)23-21(28-20-11-5-10-19(27)24(20)29-23)13-30-12-15-6-1-2-7-16(15)25(30)22(32)14-31/h1-11,14,25H,12-13,27H2 |
| InChIKey | PHXYKQDWOBOCBI-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 89.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.91 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|