C21H14ClFIN7 — CID 69089077
1-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-3-(iodomethyl)pyrazolo[3,4-d]pyrimidin-4-amine (PubChem CID 69089077) has the molecular formula C21H14ClFIN7 and a molecular weight of 545.75 g/mol. Its IUPAC name is 1-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-3-(iodomethyl)pyrazolo[3,4-d]pyrimidin-4-amine.
| Compound Name | 1-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-3-(iodomethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 69089077 |
| Molecular Formula | C21H14ClFIN7 |
| Molecular Weight | 545.75 g/mol |
| Exact Mass | 545.00 |
| IUPAC Name | 1-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-3-(iodomethyl)pyrazolo[3,4-d]pyrimidin-4-amine |
| SMILES | Nc1ncnc2c1c(CI)nn2Cc1nc2c(F)cccc2nc1-c1ccccc1Cl |
| InChI | InChI=1S/C21H14ClFIN7/c22-12-5-2-1-4-11(12)18-16(29-19-13(23)6-3-7-14(19)28-18)9-31-21-17(15(8-24)30-31)20(25)26-10-27-21/h1-7,10H,8-9H2,(H2,25,26,27) |
| InChIKey | VQXKBARJEGQHCT-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.75 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|