C20H13ClFN7 — CID 25071910
N-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-7H-purin-6-amine (PubChem CID 25071910) has the molecular formula C20H13ClFN7 and a molecular weight of 405.82 g/mol. Its IUPAC name is N-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-7H-purin-6-amine.
| Compound Name | N-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-7H-purin-6-amine |
|---|---|
| PubChem CID | 25071910 |
| Molecular Formula | C20H13ClFN7 |
| Molecular Weight | 405.82 g/mol |
| Exact Mass | 405.09 |
| IUPAC Name | N-[[3-(2-chlorophenyl)-8-fluoroquinoxalin-2-yl]methyl]-7H-purin-6-amine |
| SMILES | Fc1cccc2nc(-c3ccccc3Cl)c(CNc3ncnc4nc[nH]c34)nc12 |
| InChI | InChI=1S/C20H13ClFN7/c21-12-5-2-1-4-11(12)16-15(29-17-13(22)6-3-7-14(17)28-16)8-23-19-18-20(25-9-24-18)27-10-26-19/h1-7,9-10H,8H2,(H2,23,24,25,26,27) |
| InChIKey | HJVJYEDGZBBTAV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.82 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |